C18H15NO2 — CID 62206433
1-(1-benzofuran-2-yl)-2-(1,3-dihydroisoindol-2-yl)ethanone (PubChem CID 62206433) has the molecular formula C18H15NO2 and a molecular weight of 277.32 g/mol. Its IUPAC name is 1-(1-benzofuran-2-yl)-2-(1,3-dihydroisoindol-2-yl)ethanone.
| Compound Name | 1-(1-benzofuran-2-yl)-2-(1,3-dihydroisoindol-2-yl)ethanone |
|---|---|
| PubChem CID | 62206433 |
| Molecular Formula | C18H15NO2 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 1-(1-benzofuran-2-yl)-2-(1,3-dihydroisoindol-2-yl)ethanone |
| SMILES | O=C(CN1Cc2ccccc2C1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C18H15NO2/c20-16(18-9-13-5-3-4-8-17(13)21-18)12-19-10-14-6-1-2-7-15(14)11-19/h1-9H,10-12H2 |
| InChIKey | LSTSGTJXRBFCIP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |