C16H19NO3 — CID 62024611
1-(1-benzofuran-2-yl)-2-[4-(hydroxymethyl)piperidin-1-yl]ethanone (PubChem CID 62024611) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is 1-(1-benzofuran-2-yl)-2-[4-(hydroxymethyl)piperidin-1-yl]ethanone.
| Compound Name | 1-(1-benzofuran-2-yl)-2-[4-(hydroxymethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 62024611 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 1-(1-benzofuran-2-yl)-2-[4-(hydroxymethyl)piperidin-1-yl]ethanone |
| SMILES | O=C(CN1CCC(CO)CC1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C16H19NO3/c18-11-12-5-7-17(8-6-12)10-14(19)16-9-13-3-1-2-4-15(13)20-16/h1-4,9,12,18H,5-8,10-11H2 |
| InChIKey | POXFAGNLTDWIBO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |