C16H19NO3 — CID 62974685
1-(1-benzofuran-2-yl)-2-(2-methyl-1,4-oxazepan-4-yl)ethanone (PubChem CID 62974685) has the molecular formula C16H19NO3 and a molecular weight of 273.33 g/mol. Its IUPAC name is 1-(1-benzofuran-2-yl)-2-(2-methyl-1,4-oxazepan-4-yl)ethanone.
| Compound Name | 1-(1-benzofuran-2-yl)-2-(2-methyl-1,4-oxazepan-4-yl)ethanone |
|---|---|
| PubChem CID | 62974685 |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 1-(1-benzofuran-2-yl)-2-(2-methyl-1,4-oxazepan-4-yl)ethanone |
| SMILES | CC1CN(CC(=O)c2cc3ccccc3o2)CCCO1 |
| InChI | InChI=1S/C16H19NO3/c1-12-10-17(7-4-8-19-12)11-14(18)16-9-13-5-2-3-6-15(13)20-16/h2-3,5-6,9,12H,4,7-8,10-11H2,1H3 |
| InChIKey | ZOULASXXIDQRJU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |