C14H17F2NO2 — CID 55153158
1-(2,6-difluorophenyl)-2-(2-methyl-1,4-oxazepan-4-yl)ethanone (PubChem CID 55153158) has the molecular formula C14H17F2NO2 and a molecular weight of 269.29 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-2-(2-methyl-1,4-oxazepan-4-yl)ethanone.
| Compound Name | 1-(2,6-difluorophenyl)-2-(2-methyl-1,4-oxazepan-4-yl)ethanone |
|---|---|
| PubChem CID | 55153158 |
| Molecular Formula | C14H17F2NO2 |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 1-(2,6-difluorophenyl)-2-(2-methyl-1,4-oxazepan-4-yl)ethanone |
| SMILES | CC1CN(CC(=O)c2c(F)cccc2F)CCCO1 |
| InChI | InChI=1S/C14H17F2NO2/c1-10-8-17(6-3-7-19-10)9-13(18)14-11(15)4-2-5-12(14)16/h2,4-5,10H,3,6-9H2,1H3 |
| InChIKey | IRWBWEWPSTTYKH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |