C18H18BrN3O — CID 44656789
1-phenyl-2-(1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium-10-yl)ethanone bromide (PubChem CID 44656789) has the molecular formula C18H18BrN3O and a molecular weight of 372.27 g/mol. Its IUPAC name is 1-phenyl-2-(1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium-10-yl)ethanone bromide.
| Compound Name | 1-phenyl-2-(1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium-10-yl)ethanone bromide |
|---|---|
| PubChem CID | 44656789 |
| Molecular Formula | C18H18BrN3O |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 1-phenyl-2-(1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium-10-yl)ethanone bromide |
| SMILES | O=C(Cn1c2[n+](c3ccccc31)CCCN2)c1ccccc1.[Br-] |
| InChI | InChI=1S/C18H17N3O.BrH/c22-17(14-7-2-1-3-8-14)13-21-16-10-5-4-9-15(16)20-12-6-11-19-18(20)21;/h1-5,7-10H,6,11-13H2;1H |
| InChIKey | ICGCLTUIFJPMEF-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|