C15H19N2O+ — CID 20578741
2-(2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-5-ium-1-yl)-1-phenylethanone (PubChem CID 20578741) has the molecular formula C15H19N2O+ and a molecular weight of 243.33 g/mol. Its IUPAC name is 2-(2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-5-ium-1-yl)-1-phenylethanone.
| Compound Name | 2-(2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-5-ium-1-yl)-1-phenylethanone |
|---|---|
| PubChem CID | 20578741 |
| Molecular Formula | C15H19N2O+ |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 2-(2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidin-5-ium-1-yl)-1-phenylethanone |
| SMILES | O=C(CN1CCC[N+]2=C1CCC2)c1ccccc1 |
| InChI | InChI=1S/C15H19N2O/c18-14(13-6-2-1-3-7-13)12-17-11-5-10-16-9-4-8-15(16)17/h1-3,6-7H,4-5,8-12H2/q+1 |
| InChIKey | UVHXAEJNDRBAKR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 23.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|