C27H28BN2O — CID 91007358
CID 91007358 (PubChem CID 91007358) has the molecular formula C27H28BN2O and a molecular weight of 407.35 g/mol.
| Compound Name | CID 91007358 |
|---|---|
| PubChem CID | 91007358 |
| Molecular Formula | C27H28BN2O |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | — |
| SMILES | O=C(CN1CCC[N+]2=C1CCC2)c1ccc(-c2ccccc2)cc1.[B-]c1ccccc1 |
| InChI | InChI=1S/C21H23N2O.C6H5B/c24-20(16-23-15-5-14-22-13-4-8-21(22)23)19-11-9-18(10-12-19)17-6-2-1-3-7-17;7-6-4-2-1-3-5-6/h1-3,6-7,9-12H,4-5,8,13-16H2;1-5H/q+1;-1 |
| InChIKey | LBCZKPCYOZLEPP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 23.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|