C30H30BFN2O+ — CID 159380264
CID 159380264 (PubChem CID 159380264) has the molecular formula C30H30BFN2O+ and a molecular weight of 464.39 g/mol.
| Compound Name | CID 159380264 |
|---|---|
| PubChem CID | 159380264 |
| Molecular Formula | C30H30BFN2O+ |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | — |
| SMILES | C[B]c1cccc(F)c1.O=C(CN1CCC[N+]2=C1CCC2)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C23H23N2O.C7H7BF/c26-21(16-25-14-6-13-24-12-5-11-22(24)25)23-19-9-3-1-7-17(19)15-18-8-2-4-10-20(18)23;1-8-6-3-2-4-7(9)5-6/h1-4,7-10,15H,5-6,11-14,16H2;2-5H,1H3/q+1; |
| InChIKey | RGPHGBDYESLXGA-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 23.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|