C29H15F16NO — CID 164889710
1-[1-benzyl-2-(4-fluorophenyl)indol-3-yl]-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-one (PubChem CID 164889710) has the molecular formula C29H15F16NO and a molecular weight of 697.41 g/mol. Its IUPAC name is 1-[1-benzyl-2-(4-fluorophenyl)indol-3-yl]-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-one.
| Compound Name | 1-[1-benzyl-2-(4-fluorophenyl)indol-3-yl]-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-one |
|---|---|
| PubChem CID | 164889710 |
| Molecular Formula | C29H15F16NO |
| Molecular Weight | 697.41 g/mol |
| Exact Mass | 697.09 |
| IUPAC Name | 1-[1-benzyl-2-(4-fluorophenyl)indol-3-yl]-2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctan-1-one |
| SMILES | O=C(c1c(-c2ccc(F)cc2)n(Cc2ccccc2)c2ccccc12)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C29H15F16NO/c30-17-12-10-16(11-13-17)21-20(18-8-4-5-9-19(18)46(21)14-15-6-2-1-3-7-15)22(47)23(31,32)24(33,34)25(35,36)26(37,38)27(39,40)28(41,42)29(43,44)45/h1-13H,14H2 |
| InChIKey | PRGDKTPNTOHGMR-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.41 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|