C23H14BrF6N — CID 162539599
1-benzyl-2-[3,5-bis(trifluoromethyl)phenyl]-3-bromoindole (PubChem CID 162539599) has the molecular formula C23H14BrF6N and a molecular weight of 498.26 g/mol. Its IUPAC name is 1-benzyl-2-[3,5-bis(trifluoromethyl)phenyl]-3-bromoindole.
| Compound Name | 1-benzyl-2-[3,5-bis(trifluoromethyl)phenyl]-3-bromoindole |
|---|---|
| PubChem CID | 162539599 |
| Molecular Formula | C23H14BrF6N |
| Molecular Weight | 498.26 g/mol |
| Exact Mass | 497.02 |
| IUPAC Name | 1-benzyl-2-[3,5-bis(trifluoromethyl)phenyl]-3-bromoindole |
| SMILES | FC(F)(F)c1cc(-c2c(Br)c3ccccc3n2Cc2ccccc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H14BrF6N/c24-20-18-8-4-5-9-19(18)31(13-14-6-2-1-3-7-14)21(20)15-10-16(22(25,26)27)12-17(11-15)23(28,29)30/h1-12H,13H2 |
| InChIKey | FILPSMXXYQUYST-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.26 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |