C34H16F18N2 — CID 138757291
1-benzyl-2,4,5-tris[3,5-bis(trifluoromethyl)phenyl]imidazole (PubChem CID 138757291) has the molecular formula C34H16F18N2 and a molecular weight of 794.48 g/mol. Its IUPAC name is 1-benzyl-2,4,5-tris[3,5-bis(trifluoromethyl)phenyl]imidazole.
| Compound Name | 1-benzyl-2,4,5-tris[3,5-bis(trifluoromethyl)phenyl]imidazole |
|---|---|
| PubChem CID | 138757291 |
| Molecular Formula | C34H16F18N2 |
| Molecular Weight | 794.48 g/mol |
| Exact Mass | 794.10 |
| IUPAC Name | 1-benzyl-2,4,5-tris[3,5-bis(trifluoromethyl)phenyl]imidazole |
| SMILES | FC(F)(F)c1cc(-c2nc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)n(Cc3ccccc3)c2-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C34H16F18N2/c35-29(36,37)20-6-17(7-21(12-20)30(38,39)40)26-27(18-8-22(31(41,42)43)13-23(9-18)32(44,45)46)54(15-16-4-2-1-3-5-16)28(53-26)19-10-24(33(47,48)49)14-25(11-19)34(50,51)52/h1-14H,15H2 |
| InChIKey | QTLMJHZPGWDGNP-UHFFFAOYSA-N |
| XLogP | 13.05 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.48 |
| LogP ≤ 5 | 13.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |