C33H26F6N4O3 — CID 142732325
4-[[2-[3,5-bis(trifluoromethyl)phenyl]-4,5-bis(4-methoxyphenyl)imidazol-1-yl]methyl]-N'-hydroxybenzenecarboximidamide (PubChem CID 142732325) has the molecular formula C33H26F6N4O3 and a molecular weight of 640.58 g/mol. Its IUPAC name is 4-[[2-[3,5-bis(trifluoromethyl)phenyl]-4,5-bis(4-methoxyphenyl)imidazol-1-yl]methyl]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[[2-[3,5-bis(trifluoromethyl)phenyl]-4,5-bis(4-methoxyphenyl)imidazol-1-yl]methyl]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 142732325 |
| Molecular Formula | C33H26F6N4O3 |
| Molecular Weight | 640.58 g/mol |
| Exact Mass | 640.19 |
| IUPAC Name | 4-[[2-[3,5-bis(trifluoromethyl)phenyl]-4,5-bis(4-methoxyphenyl)imidazol-1-yl]methyl]-N'-hydroxybenzenecarboximidamide |
| SMILES | COc1ccc(-c2nc(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)n(Cc3ccc(C(N)=NO)cc3)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C33H26F6N4O3/c1-45-26-11-7-20(8-12-26)28-29(21-9-13-27(46-2)14-10-21)43(18-19-3-5-22(6-4-19)30(40)42-44)31(41-28)23-15-24(32(34,35)36)17-25(16-23)33(37,38)39/h3-17,44H,18H2,1-2H3,(H2,40,42) |
| InChIKey | LKJKDLQVHCCYBP-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.58 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|