C38H36F5N3O5 — CID 160699827
4-[2-(2-aminoethoxy)ethoxy]-1-[4-[[4-[4-(hydroxymethyl)phenyl]-5-(4-methoxyphenyl)-2-(2,3,4,5,6-pentafluorophenyl)imidazol-1-yl]methyl]phenyl]butan-1-one (PubChem CID 160699827) has the molecular formula C38H36F5N3O5 and a molecular weight of 709.71 g/mol. Its IUPAC name is 4-[2-(2-aminoethoxy)ethoxy]-1-[4-[[4-[4-(hydroxymethyl)phenyl]-5-(4-methoxyphenyl)-2-(2,3,4,5,6-pentafluorophenyl)imidazol-1-yl]methyl]phenyl]butan-1-one.
| Compound Name | 4-[2-(2-aminoethoxy)ethoxy]-1-[4-[[4-[4-(hydroxymethyl)phenyl]-5-(4-methoxyphenyl)-2-(2,3,4,5,6-pentafluorophenyl)imidazol-1-yl]methyl]phenyl]butan-1-one |
|---|---|
| PubChem CID | 160699827 |
| Molecular Formula | C38H36F5N3O5 |
| Molecular Weight | 709.71 g/mol |
| Exact Mass | 709.26 |
| IUPAC Name | 4-[2-(2-aminoethoxy)ethoxy]-1-[4-[[4-[4-(hydroxymethyl)phenyl]-5-(4-methoxyphenyl)-2-(2,3,4,5,6-pentafluorophenyl)imidazol-1-yl]methyl]phenyl]butan-1-one |
| SMILES | COc1ccc(-c2c(-c3ccc(CO)cc3)nc(-c3c(F)c(F)c(F)c(F)c3F)n2Cc2ccc(C(=O)CCCOCCOCCN)cc2)cc1 |
| InChI | InChI=1S/C38H36F5N3O5/c1-49-28-14-12-27(13-15-28)37-36(26-10-6-24(22-47)7-11-26)45-38(30-31(39)33(41)35(43)34(42)32(30)40)46(37)21-23-4-8-25(9-5-23)29(48)3-2-17-50-19-20-51-18-16-44/h4-15,47H,2-3,16-22,44H2,1H3 |
| InChIKey | VABNDZNBWGJVON-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.71 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|