C36H39N5O5 — CID 122436657
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[4,5-bis(4-methoxyphenyl)-2-pyridin-3-ylimidazol-1-yl]methyl]benzamide (PubChem CID 122436657) has the molecular formula C36H39N5O5 and a molecular weight of 621.74 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[4,5-bis(4-methoxyphenyl)-2-pyridin-3-ylimidazol-1-yl]methyl]benzamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[4,5-bis(4-methoxyphenyl)-2-pyridin-3-ylimidazol-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 122436657 |
| Molecular Formula | C36H39N5O5 |
| Molecular Weight | 621.74 g/mol |
| Exact Mass | 621.30 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[4,5-bis(4-methoxyphenyl)-2-pyridin-3-ylimidazol-1-yl]methyl]benzamide |
| SMILES | COc1ccc(-c2nc(-c3cccnc3)n(Cc3ccc(C(=O)NCCOCCOCCN)cc3)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C36H39N5O5/c1-43-31-13-9-27(10-14-31)33-34(28-11-15-32(44-2)16-12-28)41(35(40-33)30-4-3-18-38-24-30)25-26-5-7-29(8-6-26)36(42)39-19-21-46-23-22-45-20-17-37/h3-16,18,24H,17,19-23,25,37H2,1-2H3,(H,39,42) |
| InChIKey | VYXMYDDIWSATCI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.74 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|