C38H39F2N3O5 — CID 160923208
4-[2-(2-aminoethoxy)ethoxy]-1-[4-[[2-(3,5-dimethoxyphenyl)-4,5-bis(4-fluorophenyl)imidazol-1-yl]methyl]phenyl]butan-1-one (PubChem CID 160923208) has the molecular formula C38H39F2N3O5 and a molecular weight of 655.74 g/mol. Its IUPAC name is 4-[2-(2-aminoethoxy)ethoxy]-1-[4-[[2-(3,5-dimethoxyphenyl)-4,5-bis(4-fluorophenyl)imidazol-1-yl]methyl]phenyl]butan-1-one.
| Compound Name | 4-[2-(2-aminoethoxy)ethoxy]-1-[4-[[2-(3,5-dimethoxyphenyl)-4,5-bis(4-fluorophenyl)imidazol-1-yl]methyl]phenyl]butan-1-one |
|---|---|
| PubChem CID | 160923208 |
| Molecular Formula | C38H39F2N3O5 |
| Molecular Weight | 655.74 g/mol |
| Exact Mass | 655.29 |
| IUPAC Name | 4-[2-(2-aminoethoxy)ethoxy]-1-[4-[[2-(3,5-dimethoxyphenyl)-4,5-bis(4-fluorophenyl)imidazol-1-yl]methyl]phenyl]butan-1-one |
| SMILES | COc1cc(OC)cc(-c2nc(-c3ccc(F)cc3)c(-c3ccc(F)cc3)n2Cc2ccc(C(=O)CCCOCCOCCN)cc2)c1 |
| InChI | InChI=1S/C38H39F2N3O5/c1-45-33-22-30(23-34(24-33)46-2)38-42-36(28-9-13-31(39)14-10-28)37(29-11-15-32(40)16-12-29)43(38)25-26-5-7-27(8-6-26)35(44)4-3-18-47-20-21-48-19-17-41/h5-16,22-24H,3-4,17-21,25,41H2,1-2H3 |
| InChIKey | XXLKAFDODFSJJU-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.74 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|