C39H44N4O3 — CID 122436606
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[2-(3,5-dimethylphenyl)-4,5-bis(2-methylphenyl)imidazol-1-yl]methyl]benzamide (PubChem CID 122436606) has the molecular formula C39H44N4O3 and a molecular weight of 616.81 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[2-(3,5-dimethylphenyl)-4,5-bis(2-methylphenyl)imidazol-1-yl]methyl]benzamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[2-(3,5-dimethylphenyl)-4,5-bis(2-methylphenyl)imidazol-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 122436606 |
| Molecular Formula | C39H44N4O3 |
| Molecular Weight | 616.81 g/mol |
| Exact Mass | 616.34 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[2-(3,5-dimethylphenyl)-4,5-bis(2-methylphenyl)imidazol-1-yl]methyl]benzamide |
| SMILES | Cc1cc(C)cc(-c2nc(-c3ccccc3C)c(-c3ccccc3C)n2Cc2ccc(C(=O)NCCOCCOCCN)cc2)c1 |
| InChI | InChI=1S/C39H44N4O3/c1-27-23-28(2)25-33(24-27)38-42-36(34-11-7-5-9-29(34)3)37(35-12-8-6-10-30(35)4)43(38)26-31-13-15-32(16-14-31)39(44)41-18-20-46-22-21-45-19-17-40/h5-16,23-25H,17-22,26,40H2,1-4H3,(H,41,44) |
| InChIKey | HGHXKLIKLJSPQA-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.81 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|