C25H36N2O5 — CID 156719233
N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-9-(hydroxymethyl)-9H-fluorene-2-carboxamide;ethane (PubChem CID 156719233) has the molecular formula C25H36N2O5 and a molecular weight of 444.57 g/mol. Its IUPAC name is N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-9-(hydroxymethyl)-9H-fluorene-2-carboxamide;ethane.
| Compound Name | N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-9-(hydroxymethyl)-9H-fluorene-2-carboxamide;ethane |
|---|---|
| PubChem CID | 156719233 |
| Molecular Formula | C25H36N2O5 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]-9-(hydroxymethyl)-9H-fluorene-2-carboxamide;ethane |
| SMILES | CC.NCCOCCOCCOCCNC(=O)c1ccc2c(c1)C(CO)c1ccccc1-2 |
| InChI | InChI=1S/C23H30N2O5.C2H6/c24-7-9-28-11-13-30-14-12-29-10-8-25-23(27)17-5-6-20-18-3-1-2-4-19(18)22(16-26)21(20)15-17;1-2/h1-6,15,22,26H,7-14,16,24H2,(H,25,27);1-2H3 |
| InChIKey | NTTCCIAZEZVGGV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|