C23H27NO7 — CID 67983888
9-(hydroxymethyl)-7-[2-[2-(2-methoxyethoxy)ethoxy]ethylcarbamoyl]-9H-fluorene-2-carboxylic acid (PubChem CID 67983888) has the molecular formula C23H27NO7 and a molecular weight of 429.47 g/mol. Its IUPAC name is 9-(hydroxymethyl)-7-[2-[2-(2-methoxyethoxy)ethoxy]ethylcarbamoyl]-9H-fluorene-2-carboxylic acid.
| Compound Name | 9-(hydroxymethyl)-7-[2-[2-(2-methoxyethoxy)ethoxy]ethylcarbamoyl]-9H-fluorene-2-carboxylic acid |
|---|---|
| PubChem CID | 67983888 |
| Molecular Formula | C23H27NO7 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | 9-(hydroxymethyl)-7-[2-[2-(2-methoxyethoxy)ethoxy]ethylcarbamoyl]-9H-fluorene-2-carboxylic acid |
| SMILES | COCCOCCOCCNC(=O)c1ccc2c(c1)C(CO)c1cc(C(=O)O)ccc1-2 |
| InChI | InChI=1S/C23H27NO7/c1-29-8-9-31-11-10-30-7-6-24-22(26)15-2-4-17-18-5-3-16(23(27)28)13-20(18)21(14-25)19(17)12-15/h2-5,12-13,21,25H,6-11,14H2,1H3,(H,24,26)(H,27,28) |
| InChIKey | NKZFWVBVLFPWFS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|