C27H31N2O5P — CID 59766031
methyl 4-[2-[2-(2-aminoethoxy)ethoxy]ethylcarbamoyl]-2-diphenylphosphanylbenzoate (PubChem CID 59766031) has the molecular formula C27H31N2O5P and a molecular weight of 494.53 g/mol. Its IUPAC name is methyl 4-[2-[2-(2-aminoethoxy)ethoxy]ethylcarbamoyl]-2-diphenylphosphanylbenzoate.
| Compound Name | methyl 4-[2-[2-(2-aminoethoxy)ethoxy]ethylcarbamoyl]-2-diphenylphosphanylbenzoate |
|---|---|
| PubChem CID | 59766031 |
| Molecular Formula | C27H31N2O5P |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | methyl 4-[2-[2-(2-aminoethoxy)ethoxy]ethylcarbamoyl]-2-diphenylphosphanylbenzoate |
| SMILES | COC(=O)c1ccc(C(=O)NCCOCCOCCN)cc1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H31N2O5P/c1-32-27(31)24-13-12-21(26(30)29-15-17-34-19-18-33-16-14-28)20-25(24)35(22-8-4-2-5-9-22)23-10-6-3-7-11-23/h2-13,20H,14-19,28H2,1H3,(H,29,30) |
| InChIKey | LVSZUSXVFBGZPM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|