C22H19FN2O2 — CID 20930563
2-(3,5-dimethoxyphenyl)-1-[(4-fluorophenyl)methyl]benzimidazole (PubChem CID 20930563) has the molecular formula C22H19FN2O2 and a molecular weight of 362.40 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)-1-[(4-fluorophenyl)methyl]benzimidazole.
| Compound Name | 2-(3,5-dimethoxyphenyl)-1-[(4-fluorophenyl)methyl]benzimidazole |
|---|---|
| PubChem CID | 20930563 |
| Molecular Formula | C22H19FN2O2 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)-1-[(4-fluorophenyl)methyl]benzimidazole |
| SMILES | COc1cc(OC)cc(-c2nc3ccccc3n2Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C22H19FN2O2/c1-26-18-11-16(12-19(13-18)27-2)22-24-20-5-3-4-6-21(20)25(22)14-15-7-9-17(23)10-8-15/h3-13H,14H2,1-2H3 |
| InChIKey | NZLPWNLVSZBNMK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |