C23H22N2O2 — CID 20930584
2-(3,5-dimethoxyphenyl)-1-[(4-methylphenyl)methyl]benzimidazole (PubChem CID 20930584) has the molecular formula C23H22N2O2 and a molecular weight of 358.44 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)-1-[(4-methylphenyl)methyl]benzimidazole.
| Compound Name | 2-(3,5-dimethoxyphenyl)-1-[(4-methylphenyl)methyl]benzimidazole |
|---|---|
| PubChem CID | 20930584 |
| Molecular Formula | C23H22N2O2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)-1-[(4-methylphenyl)methyl]benzimidazole |
| SMILES | COc1cc(OC)cc(-c2nc3ccccc3n2Cc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C23H22N2O2/c1-16-8-10-17(11-9-16)15-25-22-7-5-4-6-21(22)24-23(25)18-12-19(26-2)14-20(13-18)27-3/h4-14H,15H2,1-3H3 |
| InChIKey | DHGWHIDKSITNMD-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |