C23H21FN2O3 — CID 20930588
1-[(3-fluorophenyl)methyl]-2-(3,4,5-trimethoxyphenyl)benzimidazole (PubChem CID 20930588) has the molecular formula C23H21FN2O3 and a molecular weight of 392.43 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-2-(3,4,5-trimethoxyphenyl)benzimidazole.
| Compound Name | 1-[(3-fluorophenyl)methyl]-2-(3,4,5-trimethoxyphenyl)benzimidazole |
|---|---|
| PubChem CID | 20930588 |
| Molecular Formula | C23H21FN2O3 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-2-(3,4,5-trimethoxyphenyl)benzimidazole |
| SMILES | COc1cc(-c2nc3ccccc3n2Cc2cccc(F)c2)cc(OC)c1OC |
| InChI | InChI=1S/C23H21FN2O3/c1-27-20-12-16(13-21(28-2)22(20)29-3)23-25-18-9-4-5-10-19(18)26(23)14-15-7-6-8-17(24)11-15/h4-13H,14H2,1-3H3 |
| InChIKey | OLDAZPDRTLBKMD-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |