C38H32N2O5 — CID 174813442
2-phenyl-5-[[2,4,5-tris(4-methoxyphenyl)imidazol-1-yl]methyl]benzoic acid (PubChem CID 174813442) has the molecular formula C38H32N2O5 and a molecular weight of 596.68 g/mol. Its IUPAC name is 2-phenyl-5-[[2,4,5-tris(4-methoxyphenyl)imidazol-1-yl]methyl]benzoic acid.
| Compound Name | 2-phenyl-5-[[2,4,5-tris(4-methoxyphenyl)imidazol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 174813442 |
| Molecular Formula | C38H32N2O5 |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | 2-phenyl-5-[[2,4,5-tris(4-methoxyphenyl)imidazol-1-yl]methyl]benzoic acid |
| SMILES | COc1ccc(-c2nc(-c3ccc(OC)cc3)n(Cc3ccc(-c4ccccc4)c(C(=O)O)c3)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H32N2O5/c1-43-30-16-10-27(11-17-30)35-36(28-12-18-31(44-2)19-13-28)40(37(39-35)29-14-20-32(45-3)21-15-29)24-25-9-22-33(34(23-25)38(41)42)26-7-5-4-6-8-26/h4-23H,24H2,1-3H3,(H,41,42) |
| InChIKey | IRDXJMIPYATPPG-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |