About 2-phenyl-5-[[2,4,5-tris(4-methoxyphenyl)imidazol-1-yl]methyl]benzoic acid
2-phenyl-5-[[2,4,5-tris(4-methoxyphenyl)imidazol-1-yl]methyl]benzoic acid (PubChem CID 174813442) has the molecular formula C38H32N2O5
and a molecular weight of 596.68 g/mol. Its IUPAC name is 2-phenyl-5-[[2,4,5-tris(4-methoxyphenyl)imidazol-1-yl]methyl]benzoic acid.
Molecular Properties
| Compound Name | 2-phenyl-5-[[2,4,5-tris(4-methoxyphenyl)imidazol-1-yl]methyl]benzoic acid |
| PubChem CID | 174813442 |
| Molecular Formula | C38H32N2O5 |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | 2-phenyl-5-[[2,4,5-tris(4-methoxyphenyl)imidazol-1-yl]methyl]benzoic acid |
| SMILES | COc1ccc(-c2nc(-c3ccc(OC)cc3)n(Cc3ccc(-c4ccccc4)c(C(=O)O)c3)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H32N2O5/c1-43-30-16-10-27(11-17-30)35-36(28-12-18-31(44-2)19-13-28)40(37(39-35)29-14-20-32(45-3)21-15-29)24-25-9-22-33(34(23-25)38(41)42)26-7-5-4-6-8-26/h4-23H,24H2,1-3H3,(H,41,42) |
| InChIKey | IRDXJMIPYATPPG-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-phenyl-5-[[2,4,5-tris(4-methoxyphenyl)imidazol-1-yl]methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-5-[[2,4,5-tris(4-methoxyphenyl)imidazol-1-yl]methyl]benzoic acid?
The IUPAC name of 2-phenyl-5-[[2,4,5-tris(4-methoxyphenyl)imidazol-1-yl]methyl]benzoic acid (CID 174813442) is 2-phenyl-5-[[2,4,5-tris(4-methoxyphenyl)imidazol-1-yl]methyl]benzoic acid.
What is the SMILES notation for 2-phenyl-5-[[2,4,5-tris(4-methoxyphenyl)imidazol-1-yl]methyl]benzoic acid?
The canonical SMILES for 2-phenyl-5-[[2,4,5-tris(4-methoxyphenyl)imidazol-1-yl]methyl]benzoic acid is COc1ccc(-c2nc(-c3ccc(OC)cc3)n(Cc3ccc(-c4ccccc4)c(C(=O)O)c3)c2-c2ccc(OC)cc2)cc1.
What is the InChIKey of 2-phenyl-5-[[2,4,5-tris(4-methoxyphenyl)imidazol-1-yl]methyl]benzoic acid?
The InChIKey is IRDXJMIPYATPPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H32N2O5/c1-43-30-16-10-27(11-17-30)35-36(28-12-18-31(44-2)19-13-28)40(37(39-35)29-14-20-32(45-3)21-15-29)24-25-9-22-33(34(23-25)38(41)42)26-7-5-4-6-8-26/h4-23H,24H2,1-3H3,(H,41,42).
What are the key properties of 2-phenyl-5-[[2,4,5-tris(4-methoxyphenyl)imidazol-1-yl]methyl]benzoic acid?
2-phenyl-5-[[2,4,5-tris(4-methoxyphenyl)imidazol-1-yl]methyl]benzoic acid has a molecular weight of 596.68 g/mol, XLogP of 8.32, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-5-[[2,4,5-tris(4-methoxyphenyl)imidazol-1-yl]methyl]benzoic acid is sourced from PubChem (CID 174813442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).