About 5-[(2-ethoxy-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-2-phenylbenzoic acid
5-[(2-ethoxy-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-2-phenylbenzoic acid (PubChem CID 67941649) has the molecular formula C24H23N3O3
and a molecular weight of 401.47 g/mol. Its IUPAC name is 5-[(2-ethoxy-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-2-phenylbenzoic acid.
Molecular Properties
| Compound Name | 5-[(2-ethoxy-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-2-phenylbenzoic acid |
| PubChem CID | 67941649 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 5-[(2-ethoxy-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-2-phenylbenzoic acid |
| SMILES | CCOc1nc2c(C)cc(C)nc2n1Cc1ccc(-c2ccccc2)c(C(=O)O)c1 |
| InChI | InChI=1S/C24H23N3O3/c1-4-30-24-26-21-15(2)12-16(3)25-22(21)27(24)14-17-10-11-19(20(13-17)23(28)29)18-8-6-5-7-9-18/h5-13H,4,14H2,1-3H3,(H,28,29) |
| InChIKey | FXQUSSXGUBBZSD-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(2-ethoxy-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-2-phenylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-ethoxy-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-2-phenylbenzoic acid?
The IUPAC name of 5-[(2-ethoxy-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-2-phenylbenzoic acid (CID 67941649) is 5-[(2-ethoxy-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-2-phenylbenzoic acid.
What is the SMILES notation for 5-[(2-ethoxy-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-2-phenylbenzoic acid?
The canonical SMILES for 5-[(2-ethoxy-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-2-phenylbenzoic acid is CCOc1nc2c(C)cc(C)nc2n1Cc1ccc(-c2ccccc2)c(C(=O)O)c1.
What is the InChIKey of 5-[(2-ethoxy-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-2-phenylbenzoic acid?
The InChIKey is FXQUSSXGUBBZSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23N3O3/c1-4-30-24-26-21-15(2)12-16(3)25-22(21)27(24)14-17-10-11-19(20(13-17)23(28)29)18-8-6-5-7-9-18/h5-13H,4,14H2,1-3H3,(H,28,29).
What are the key properties of 5-[(2-ethoxy-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-2-phenylbenzoic acid?
5-[(2-ethoxy-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-2-phenylbenzoic acid has a molecular weight of 401.47 g/mol, XLogP of 4.86, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-ethoxy-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]-2-phenylbenzoic acid is sourced from PubChem (CID 67941649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).