C26H23N3O2 — CID 154422376
2-[4-[(2-but-2-ynyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]benzoic acid (PubChem CID 154422376) has the molecular formula C26H23N3O2 and a molecular weight of 409.49 g/mol. Its IUPAC name is 2-[4-[(2-but-2-ynyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[(2-but-2-ynyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 154422376 |
| Molecular Formula | C26H23N3O2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 2-[4-[(2-but-2-ynyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]benzoic acid |
| SMILES | CC#CCc1nc2c(C)cc(C)nc2n1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C26H23N3O2/c1-4-5-10-23-28-24-17(2)15-18(3)27-25(24)29(23)16-19-11-13-20(14-12-19)21-8-6-7-9-22(21)26(30)31/h6-9,11-15H,10,16H2,1-3H3,(H,30,31) |
| InChIKey | HJSHRXSONFUQDR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|