C37H32N4O2S — CID 70144596
N'-methyl-N-[2-[4-[(2,4,5-triphenylimidazol-1-yl)methyl]phenyl]phenyl]sulfonylethanimidamide (PubChem CID 70144596) has the molecular formula C37H32N4O2S and a molecular weight of 596.76 g/mol. Its IUPAC name is N'-methyl-N-[2-[4-[(2,4,5-triphenylimidazol-1-yl)methyl]phenyl]phenyl]sulfonylethanimidamide.
| Compound Name | N'-methyl-N-[2-[4-[(2,4,5-triphenylimidazol-1-yl)methyl]phenyl]phenyl]sulfonylethanimidamide |
|---|---|
| PubChem CID | 70144596 |
| Molecular Formula | C37H32N4O2S |
| Molecular Weight | 596.76 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | N'-methyl-N-[2-[4-[(2,4,5-triphenylimidazol-1-yl)methyl]phenyl]phenyl]sulfonylethanimidamide |
| SMILES | C/N=C(\C)NS(=O)(=O)c1ccccc1-c1ccc(Cn2c(-c3ccccc3)nc(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C37H32N4O2S/c1-27(38-2)40-44(42,43)34-21-13-12-20-33(34)29-24-22-28(23-25-29)26-41-36(31-16-8-4-9-17-31)35(30-14-6-3-7-15-30)39-37(41)32-18-10-5-11-19-32/h3-25H,26H2,1-2H3,(H,38,40) |
| InChIKey | BQEYHJBVBXJBNX-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.76 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|