C23H25N3O5S — CID 68718342
3-[[4-[2-(acetylsulfamoyl)phenyl]phenyl]methyl]-2-butylimidazole-4-carboxylic acid (PubChem CID 68718342) has the molecular formula C23H25N3O5S and a molecular weight of 455.54 g/mol. Its IUPAC name is 3-[[4-[2-(acetylsulfamoyl)phenyl]phenyl]methyl]-2-butylimidazole-4-carboxylic acid.
| Compound Name | 3-[[4-[2-(acetylsulfamoyl)phenyl]phenyl]methyl]-2-butylimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 68718342 |
| Molecular Formula | C23H25N3O5S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 3-[[4-[2-(acetylsulfamoyl)phenyl]phenyl]methyl]-2-butylimidazole-4-carboxylic acid |
| SMILES | CCCCc1ncc(C(=O)O)n1Cc1ccc(-c2ccccc2S(=O)(=O)NC(C)=O)cc1 |
| InChI | InChI=1S/C23H25N3O5S/c1-3-4-9-22-24-14-20(23(28)29)26(22)15-17-10-12-18(13-11-17)19-7-5-6-8-21(19)32(30,31)25-16(2)27/h5-8,10-14H,3-4,9,15H2,1-2H3,(H,25,27)(H,28,29) |
| InChIKey | BJACTWZBASIZDF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |