C27H31N3O6S2 — CID 139747846
2-[2-butyl-3-[[4-[2-(ethoxycarbonylsulfamoyl)phenyl]phenyl]methyl]-5-methylsulfanylimidazol-4-yl]prop-2-enoic acid (PubChem CID 139747846) has the molecular formula C27H31N3O6S2 and a molecular weight of 557.69 g/mol. Its IUPAC name is 2-[2-butyl-3-[[4-[2-(ethoxycarbonylsulfamoyl)phenyl]phenyl]methyl]-5-methylsulfanylimidazol-4-yl]prop-2-enoic acid.
| Compound Name | 2-[2-butyl-3-[[4-[2-(ethoxycarbonylsulfamoyl)phenyl]phenyl]methyl]-5-methylsulfanylimidazol-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 139747846 |
| Molecular Formula | C27H31N3O6S2 |
| Molecular Weight | 557.69 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | 2-[2-butyl-3-[[4-[2-(ethoxycarbonylsulfamoyl)phenyl]phenyl]methyl]-5-methylsulfanylimidazol-4-yl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)c1c(SC)nc(CCCC)n1Cc1ccc(-c2ccccc2S(=O)(=O)NC(=O)OCC)cc1 |
| InChI | InChI=1S/C27H31N3O6S2/c1-5-7-12-23-28-25(37-4)24(18(3)26(31)32)30(23)17-19-13-15-20(16-14-19)21-10-8-9-11-22(21)38(34,35)29-27(33)36-6-2/h8-11,13-16H,3,5-7,12,17H2,1-2,4H3,(H,29,33)(H,31,32) |
| InChIKey | VBUGSYWMCVIZAH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.69 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|