C28H36N4O4S3 — CID 10348372
ethyl 2-butyl-5-methylsulfanyl-3-[[4-[2-(propylcarbamothioylsulfamoyl)phenyl]phenyl]methyl]imidazole-4-carboxylate (PubChem CID 10348372) has the molecular formula C28H36N4O4S3 and a molecular weight of 588.82 g/mol. Its IUPAC name is ethyl 2-butyl-5-methylsulfanyl-3-[[4-[2-(propylcarbamothioylsulfamoyl)phenyl]phenyl]methyl]imidazole-4-carboxylate.
| Compound Name | ethyl 2-butyl-5-methylsulfanyl-3-[[4-[2-(propylcarbamothioylsulfamoyl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
|---|---|
| PubChem CID | 10348372 |
| Molecular Formula | C28H36N4O4S3 |
| Molecular Weight | 588.82 g/mol |
| Exact Mass | 588.19 |
| IUPAC Name | ethyl 2-butyl-5-methylsulfanyl-3-[[4-[2-(propylcarbamothioylsulfamoyl)phenyl]phenyl]methyl]imidazole-4-carboxylate |
| SMILES | CCCCc1nc(SC)c(C(=O)OCC)n1Cc1ccc(-c2ccccc2S(=O)(=O)NC(=S)NCCC)cc1 |
| InChI | InChI=1S/C28H36N4O4S3/c1-5-8-13-24-30-26(38-4)25(27(33)36-7-3)32(24)19-20-14-16-21(17-15-20)22-11-9-10-12-23(22)39(34,35)31-28(37)29-18-6-2/h9-12,14-17H,5-8,13,18-19H2,1-4H3,(H2,29,31,37) |
| InChIKey | HAUXDSWNMLVHAV-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.82 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|