C24H27N3O4S2 — CID 86754743
2-[2-butyl-5-methylsulfanyl-3-[[4-(2-sulfamoylphenyl)phenyl]methyl]imidazol-4-yl]prop-2-enoic acid (PubChem CID 86754743) has the molecular formula C24H27N3O4S2 and a molecular weight of 485.63 g/mol. Its IUPAC name is 2-[2-butyl-5-methylsulfanyl-3-[[4-(2-sulfamoylphenyl)phenyl]methyl]imidazol-4-yl]prop-2-enoic acid.
| Compound Name | 2-[2-butyl-5-methylsulfanyl-3-[[4-(2-sulfamoylphenyl)phenyl]methyl]imidazol-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 86754743 |
| Molecular Formula | C24H27N3O4S2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | 2-[2-butyl-5-methylsulfanyl-3-[[4-(2-sulfamoylphenyl)phenyl]methyl]imidazol-4-yl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)c1c(SC)nc(CCCC)n1Cc1ccc(-c2ccccc2S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C24H27N3O4S2/c1-4-5-10-21-26-23(32-3)22(16(2)24(28)29)27(21)15-17-11-13-18(14-12-17)19-8-6-7-9-20(19)33(25,30)31/h6-9,11-14H,2,4-5,10,15H2,1,3H3,(H,28,29)(H2,25,30,31) |
| InChIKey | WNLHEXFPXUHVFT-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|