C16H21BN2O4S — CID 18987819
3-[(4-boronophenyl)methyl]-2-butyl-5-methylsulfanylimidazole-4-carboxylic acid (PubChem CID 18987819) has the molecular formula C16H21BN2O4S and a molecular weight of 348.23 g/mol. Its IUPAC name is 3-[(4-boronophenyl)methyl]-2-butyl-5-methylsulfanylimidazole-4-carboxylic acid.
| Compound Name | 3-[(4-boronophenyl)methyl]-2-butyl-5-methylsulfanylimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 18987819 |
| Molecular Formula | C16H21BN2O4S |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 3-[(4-boronophenyl)methyl]-2-butyl-5-methylsulfanylimidazole-4-carboxylic acid |
| SMILES | CCCCc1nc(SC)c(C(=O)O)n1Cc1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C16H21BN2O4S/c1-3-4-5-13-18-15(24-2)14(16(20)21)19(13)10-11-6-8-12(9-7-11)17(22)23/h6-9,22-23H,3-5,10H2,1-2H3,(H,20,21) |
| InChIKey | JVTQCEVHLGGITI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|