C29H28N2O4S — CID 21479010
5-benzylsulfanyl-2-butyl-3-[[4-(2-carboxyphenyl)phenyl]methyl]imidazole-4-carboxylic acid (PubChem CID 21479010) has the molecular formula C29H28N2O4S and a molecular weight of 500.62 g/mol. Its IUPAC name is 5-benzylsulfanyl-2-butyl-3-[[4-(2-carboxyphenyl)phenyl]methyl]imidazole-4-carboxylic acid.
| Compound Name | 5-benzylsulfanyl-2-butyl-3-[[4-(2-carboxyphenyl)phenyl]methyl]imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 21479010 |
| Molecular Formula | C29H28N2O4S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | 5-benzylsulfanyl-2-butyl-3-[[4-(2-carboxyphenyl)phenyl]methyl]imidazole-4-carboxylic acid |
| SMILES | CCCCc1nc(SCc2ccccc2)c(C(=O)O)n1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C29H28N2O4S/c1-2-3-13-25-30-27(36-19-21-9-5-4-6-10-21)26(29(34)35)31(25)18-20-14-16-22(17-15-20)23-11-7-8-12-24(23)28(32)33/h4-12,14-17H,2-3,13,18-19H2,1H3,(H,32,33)(H,34,35) |
| InChIKey | HAVFFCDXOQHYCA-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |