C23H22N2O2S — CID 19370639
2-[4-[(2-butylthieno[2,3-d]imidazol-1-yl)methyl]phenyl]benzoic acid (PubChem CID 19370639) has the molecular formula C23H22N2O2S and a molecular weight of 390.51 g/mol. Its IUPAC name is 2-[4-[(2-butylthieno[2,3-d]imidazol-1-yl)methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[(2-butylthieno[2,3-d]imidazol-1-yl)methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 19370639 |
| Molecular Formula | C23H22N2O2S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 2-[4-[(2-butylthieno[2,3-d]imidazol-1-yl)methyl]phenyl]benzoic acid |
| SMILES | CCCCc1nc2sccc2n1Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C23H22N2O2S/c1-2-3-8-21-24-22-20(13-14-28-22)25(21)15-16-9-11-17(12-10-16)18-6-4-5-7-19(18)23(26)27/h4-7,9-14H,2-3,8,15H2,1H3,(H,26,27) |
| InChIKey | YGZZYWJSISISNV-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |