C33H37N5O6S — CID 87218862
3-[[4-[2-(acetylsulfamoyl)phenyl]phenyl]methyl]-2-butyl-N-[(2R)-4-(hydroxyamino)-4-oxo-1-phenylbutan-2-yl]imidazole-4-carboxamide (PubChem CID 87218862) has the molecular formula C33H37N5O6S and a molecular weight of 631.76 g/mol. Its IUPAC name is 3-[[4-[2-(acetylsulfamoyl)phenyl]phenyl]methyl]-2-butyl-N-[(2R)-4-(hydroxyamino)-4-oxo-1-phenylbutan-2-yl]imidazole-4-carboxamide.
| Compound Name | 3-[[4-[2-(acetylsulfamoyl)phenyl]phenyl]methyl]-2-butyl-N-[(2R)-4-(hydroxyamino)-4-oxo-1-phenylbutan-2-yl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 87218862 |
| Molecular Formula | C33H37N5O6S |
| Molecular Weight | 631.76 g/mol |
| Exact Mass | 631.25 |
| IUPAC Name | 3-[[4-[2-(acetylsulfamoyl)phenyl]phenyl]methyl]-2-butyl-N-[(2R)-4-(hydroxyamino)-4-oxo-1-phenylbutan-2-yl]imidazole-4-carboxamide |
| SMILES | CCCCc1ncc(C(=O)N[C@@H](CC(=O)NO)Cc2ccccc2)n1Cc1ccc(-c2ccccc2S(=O)(=O)NC(C)=O)cc1 |
| InChI | InChI=1S/C33H37N5O6S/c1-3-4-14-31-34-21-29(33(41)35-27(20-32(40)36-42)19-24-10-6-5-7-11-24)38(31)22-25-15-17-26(18-16-25)28-12-8-9-13-30(28)45(43,44)37-23(2)39/h5-13,15-18,21,27,42H,3-4,14,19-20,22H2,1-2H3,(H,35,41)(H,36,40)(H,37,39)/t27-/m1/s1 |
| InChIKey | SWCXVDFUGKXPTC-HHHXNRCGSA-N |
| XLogP | 4.00 |
| TPSA | 159.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.76 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|