C24H28N4O5S — CID 87218864
4-[[2-butyl-5-[[(2R)-4-(hydroxyamino)-4-oxo-1-thiophen-3-ylbutan-2-yl]carbamoyl]imidazol-1-yl]methyl]benzoic acid (PubChem CID 87218864) has the molecular formula C24H28N4O5S and a molecular weight of 484.58 g/mol. Its IUPAC name is 4-[[2-butyl-5-[[(2R)-4-(hydroxyamino)-4-oxo-1-thiophen-3-ylbutan-2-yl]carbamoyl]imidazol-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[2-butyl-5-[[(2R)-4-(hydroxyamino)-4-oxo-1-thiophen-3-ylbutan-2-yl]carbamoyl]imidazol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 87218864 |
| Molecular Formula | C24H28N4O5S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 4-[[2-butyl-5-[[(2R)-4-(hydroxyamino)-4-oxo-1-thiophen-3-ylbutan-2-yl]carbamoyl]imidazol-1-yl]methyl]benzoic acid |
| SMILES | CCCCc1ncc(C(=O)N[C@@H](CC(=O)NO)Cc2ccsc2)n1Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C24H28N4O5S/c1-2-3-4-21-25-13-20(28(21)14-16-5-7-18(8-6-16)24(31)32)23(30)26-19(12-22(29)27-33)11-17-9-10-34-15-17/h5-10,13,15,19,33H,2-4,11-12,14H2,1H3,(H,26,30)(H,27,29)(H,31,32)/t19-/m1/s1 |
| InChIKey | DFLHBQDSPKHKIT-LJQANCHMSA-N |
| XLogP | 3.27 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|