C32H40N4O8 — CID 87219030
1-propan-2-yloxycarbonyloxyethyl 4-[[2-butyl-5-[[4-(hydroxyamino)-4-oxo-1-phenylbutan-2-yl]carbamoyl]imidazol-1-yl]methyl]benzoate (PubChem CID 87219030) has the molecular formula C32H40N4O8 and a molecular weight of 608.69 g/mol. Its IUPAC name is 1-propan-2-yloxycarbonyloxyethyl 4-[[2-butyl-5-[[4-(hydroxyamino)-4-oxo-1-phenylbutan-2-yl]carbamoyl]imidazol-1-yl]methyl]benzoate.
| Compound Name | 1-propan-2-yloxycarbonyloxyethyl 4-[[2-butyl-5-[[4-(hydroxyamino)-4-oxo-1-phenylbutan-2-yl]carbamoyl]imidazol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 87219030 |
| Molecular Formula | C32H40N4O8 |
| Molecular Weight | 608.69 g/mol |
| Exact Mass | 608.28 |
| IUPAC Name | 1-propan-2-yloxycarbonyloxyethyl 4-[[2-butyl-5-[[4-(hydroxyamino)-4-oxo-1-phenylbutan-2-yl]carbamoyl]imidazol-1-yl]methyl]benzoate |
| SMILES | CCCCc1ncc(C(=O)NC(CC(=O)NO)Cc2ccccc2)n1Cc1ccc(C(=O)OC(C)OC(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C32H40N4O8/c1-5-6-12-28-33-19-27(30(38)34-26(18-29(37)35-41)17-23-10-8-7-9-11-23)36(28)20-24-13-15-25(16-14-24)31(39)43-22(4)44-32(40)42-21(2)3/h7-11,13-16,19,21-22,26,41H,5-6,12,17-18,20H2,1-4H3,(H,34,38)(H,35,37) |
| InChIKey | WOORCTMRIUEXMM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 158.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.69 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|