C26H28Cl2N4O5 — CID 87218866
4-[[2-butyl-5-[[(2R)-1-(2,4-dichlorophenyl)-4-(hydroxyamino)-4-oxobutan-2-yl]carbamoyl]imidazol-1-yl]methyl]benzoic acid (PubChem CID 87218866) has the molecular formula C26H28Cl2N4O5 and a molecular weight of 547.44 g/mol. Its IUPAC name is 4-[[2-butyl-5-[[(2R)-1-(2,4-dichlorophenyl)-4-(hydroxyamino)-4-oxobutan-2-yl]carbamoyl]imidazol-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[2-butyl-5-[[(2R)-1-(2,4-dichlorophenyl)-4-(hydroxyamino)-4-oxobutan-2-yl]carbamoyl]imidazol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 87218866 |
| Molecular Formula | C26H28Cl2N4O5 |
| Molecular Weight | 547.44 g/mol |
| Exact Mass | 546.14 |
| IUPAC Name | 4-[[2-butyl-5-[[(2R)-1-(2,4-dichlorophenyl)-4-(hydroxyamino)-4-oxobutan-2-yl]carbamoyl]imidazol-1-yl]methyl]benzoic acid |
| SMILES | CCCCc1ncc(C(=O)N[C@@H](CC(=O)NO)Cc2ccc(Cl)cc2Cl)n1Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C26H28Cl2N4O5/c1-2-3-4-23-29-14-22(32(23)15-16-5-7-17(8-6-16)26(35)36)25(34)30-20(13-24(33)31-37)11-18-9-10-19(27)12-21(18)28/h5-10,12,14,20,37H,2-4,11,13,15H2,1H3,(H,30,34)(H,31,33)(H,35,36)/t20-/m1/s1 |
| InChIKey | IPLJODQJDWHYLR-HXUWFJFHSA-N |
| XLogP | 4.52 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|