C33H33F3N8O3 — CID 87219071
2-butyl-N-[(2R)-4-(hydroxyamino)-4-oxo-1-[2-(trifluoromethyl)phenyl]butan-2-yl]-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxamide (PubChem CID 87219071) has the molecular formula C33H33F3N8O3 and a molecular weight of 646.67 g/mol. Its IUPAC name is 2-butyl-N-[(2R)-4-(hydroxyamino)-4-oxo-1-[2-(trifluoromethyl)phenyl]butan-2-yl]-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxamide.
| Compound Name | 2-butyl-N-[(2R)-4-(hydroxyamino)-4-oxo-1-[2-(trifluoromethyl)phenyl]butan-2-yl]-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 87219071 |
| Molecular Formula | C33H33F3N8O3 |
| Molecular Weight | 646.67 g/mol |
| Exact Mass | 646.26 |
| IUPAC Name | 2-butyl-N-[(2R)-4-(hydroxyamino)-4-oxo-1-[2-(trifluoromethyl)phenyl]butan-2-yl]-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]imidazole-4-carboxamide |
| SMILES | CCCCc1ncc(C(=O)N[C@@H](CC(=O)NO)Cc2ccccc2C(F)(F)F)n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C33H33F3N8O3/c1-2-3-12-29-37-19-28(32(46)38-24(18-30(45)41-47)17-23-8-4-7-11-27(23)33(34,35)36)44(29)20-21-13-15-22(16-14-21)25-9-5-6-10-26(25)31-39-42-43-40-31/h4-11,13-16,19,24,47H,2-3,12,17-18,20H2,1H3,(H,38,46)(H,41,45)(H,39,40,42,43)/t24-/m1/s1 |
| InChIKey | MSRASAJSKPKMLH-XMMPIXPASA-N |
| XLogP | 5.38 |
| TPSA | 150.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.67 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|