C25H29N7OS — CID 87219089
2-butyl-N-[(2R)-1-phenyl-3-sulfanylpropan-2-yl]-3-[[4-(2H-tetrazol-5-yl)phenyl]methyl]imidazole-4-carboxamide (PubChem CID 87219089) has the molecular formula C25H29N7OS and a molecular weight of 475.62 g/mol. Its IUPAC name is 2-butyl-N-[(2R)-1-phenyl-3-sulfanylpropan-2-yl]-3-[[4-(2H-tetrazol-5-yl)phenyl]methyl]imidazole-4-carboxamide.
| Compound Name | 2-butyl-N-[(2R)-1-phenyl-3-sulfanylpropan-2-yl]-3-[[4-(2H-tetrazol-5-yl)phenyl]methyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 87219089 |
| Molecular Formula | C25H29N7OS |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | 2-butyl-N-[(2R)-1-phenyl-3-sulfanylpropan-2-yl]-3-[[4-(2H-tetrazol-5-yl)phenyl]methyl]imidazole-4-carboxamide |
| SMILES | CCCCc1ncc(C(=O)N[C@@H](CS)Cc2ccccc2)n1Cc1ccc(-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C25H29N7OS/c1-2-3-9-23-26-15-22(25(33)27-21(17-34)14-18-7-5-4-6-8-18)32(23)16-19-10-12-20(13-11-19)24-28-30-31-29-24/h4-8,10-13,15,21,34H,2-3,9,14,16-17H2,1H3,(H,27,33)(H,28,29,30,31)/t21-/m1/s1 |
| InChIKey | NWHROIGSONCHIB-OAQYLSRUSA-N |
| XLogP | 3.72 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|