C29H33F3N4O5 — CID 87218688
1,1,1-trifluoropropan-2-yl 4-[[2-butyl-5-[[4-(hydroxyamino)-4-oxo-1-phenylbutan-2-yl]carbamoyl]imidazol-1-yl]methyl]benzoate (PubChem CID 87218688) has the molecular formula C29H33F3N4O5 and a molecular weight of 574.60 g/mol. Its IUPAC name is 1,1,1-trifluoropropan-2-yl 4-[[2-butyl-5-[[4-(hydroxyamino)-4-oxo-1-phenylbutan-2-yl]carbamoyl]imidazol-1-yl]methyl]benzoate.
| Compound Name | 1,1,1-trifluoropropan-2-yl 4-[[2-butyl-5-[[4-(hydroxyamino)-4-oxo-1-phenylbutan-2-yl]carbamoyl]imidazol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 87218688 |
| Molecular Formula | C29H33F3N4O5 |
| Molecular Weight | 574.60 g/mol |
| Exact Mass | 574.24 |
| IUPAC Name | 1,1,1-trifluoropropan-2-yl 4-[[2-butyl-5-[[4-(hydroxyamino)-4-oxo-1-phenylbutan-2-yl]carbamoyl]imidazol-1-yl]methyl]benzoate |
| SMILES | CCCCc1ncc(C(=O)NC(CC(=O)NO)Cc2ccccc2)n1Cc1ccc(C(=O)OC(C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C29H33F3N4O5/c1-3-4-10-25-33-17-24(27(38)34-23(16-26(37)35-40)15-20-8-6-5-7-9-20)36(25)18-21-11-13-22(14-12-21)28(39)41-19(2)29(30,31)32/h5-9,11-14,17,19,23,40H,3-4,10,15-16,18H2,1-2H3,(H,34,38)(H,35,37) |
| InChIKey | NKSVQHFSBFFUNC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.60 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|