C34H35F3N4O6 — CID 87219158
[4-(trifluoromethoxy)phenyl]methyl 4-[[2-butyl-5-[[4-(hydroxyamino)-4-oxo-1-phenylbutan-2-yl]carbamoyl]imidazol-1-yl]methyl]benzoate (PubChem CID 87219158) has the molecular formula C34H35F3N4O6 and a molecular weight of 652.67 g/mol. Its IUPAC name is [4-(trifluoromethoxy)phenyl]methyl 4-[[2-butyl-5-[[4-(hydroxyamino)-4-oxo-1-phenylbutan-2-yl]carbamoyl]imidazol-1-yl]methyl]benzoate.
| Compound Name | [4-(trifluoromethoxy)phenyl]methyl 4-[[2-butyl-5-[[4-(hydroxyamino)-4-oxo-1-phenylbutan-2-yl]carbamoyl]imidazol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 87219158 |
| Molecular Formula | C34H35F3N4O6 |
| Molecular Weight | 652.67 g/mol |
| Exact Mass | 652.25 |
| IUPAC Name | [4-(trifluoromethoxy)phenyl]methyl 4-[[2-butyl-5-[[4-(hydroxyamino)-4-oxo-1-phenylbutan-2-yl]carbamoyl]imidazol-1-yl]methyl]benzoate |
| SMILES | CCCCc1ncc(C(=O)NC(CC(=O)NO)Cc2ccccc2)n1Cc1ccc(C(=O)OCc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C34H35F3N4O6/c1-2-3-9-30-38-20-29(32(43)39-27(19-31(42)40-45)18-23-7-5-4-6-8-23)41(30)21-24-10-14-26(15-11-24)33(44)46-22-25-12-16-28(17-13-25)47-34(35,36)37/h4-8,10-17,20,27,45H,2-3,9,18-19,21-22H2,1H3,(H,39,43)(H,40,42) |
| InChIKey | GEYJRQROJLYUCL-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.67 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|