C32H39N5O8 — CID 151763355
4-[[5-[[(5S)-5-[[2-benzyl-3-(hydroxyamino)-3-oxopropanoyl]amino]-5-carboxypentyl]carbamoyl]-2-butylimidazol-1-yl]methyl]benzoic acid (PubChem CID 151763355) has the molecular formula C32H39N5O8 and a molecular weight of 621.69 g/mol. Its IUPAC name is 4-[[5-[[(5S)-5-[[2-benzyl-3-(hydroxyamino)-3-oxopropanoyl]amino]-5-carboxypentyl]carbamoyl]-2-butylimidazol-1-yl]methyl]benzoic acid.
| Compound Name | 4-[[5-[[(5S)-5-[[2-benzyl-3-(hydroxyamino)-3-oxopropanoyl]amino]-5-carboxypentyl]carbamoyl]-2-butylimidazol-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 151763355 |
| Molecular Formula | C32H39N5O8 |
| Molecular Weight | 621.69 g/mol |
| Exact Mass | 621.28 |
| IUPAC Name | 4-[[5-[[(5S)-5-[[2-benzyl-3-(hydroxyamino)-3-oxopropanoyl]amino]-5-carboxypentyl]carbamoyl]-2-butylimidazol-1-yl]methyl]benzoic acid |
| SMILES | CCCCc1ncc(C(=O)NCCCC[C@H](NC(=O)C(Cc2ccccc2)C(=O)NO)C(=O)O)n1Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C32H39N5O8/c1-2-3-12-27-34-19-26(37(27)20-22-13-15-23(16-14-22)31(41)42)30(40)33-17-8-7-11-25(32(43)44)35-28(38)24(29(39)36-45)18-21-9-5-4-6-10-21/h4-6,9-10,13-16,19,24-25,45H,2-3,7-8,11-12,17-18,20H2,1H3,(H,33,40)(H,35,38)(H,36,39)(H,41,42)(H,43,44)/t24?,25-/m0/s1 |
| InChIKey | RRALSMZENGRJJA-BBMPLOMVSA-N |
| XLogP | 2.81 |
| TPSA | 199.95 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.69 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|