C32H33F2N5O6S — CID 87185283
1-[[4-[2-(acetylsulfamoyl)phenyl]-2,6-difluorophenyl]methyl]-N-[(2R)-4-(hydroxyamino)-4-oxo-1-phenylbutan-2-yl]-5-propylpyrazole-3-carboxamide (PubChem CID 87185283) has the molecular formula C32H33F2N5O6S and a molecular weight of 653.71 g/mol. Its IUPAC name is 1-[[4-[2-(acetylsulfamoyl)phenyl]-2,6-difluorophenyl]methyl]-N-[(2R)-4-(hydroxyamino)-4-oxo-1-phenylbutan-2-yl]-5-propylpyrazole-3-carboxamide.
| Compound Name | 1-[[4-[2-(acetylsulfamoyl)phenyl]-2,6-difluorophenyl]methyl]-N-[(2R)-4-(hydroxyamino)-4-oxo-1-phenylbutan-2-yl]-5-propylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 87185283 |
| Molecular Formula | C32H33F2N5O6S |
| Molecular Weight | 653.71 g/mol |
| Exact Mass | 653.21 |
| IUPAC Name | 1-[[4-[2-(acetylsulfamoyl)phenyl]-2,6-difluorophenyl]methyl]-N-[(2R)-4-(hydroxyamino)-4-oxo-1-phenylbutan-2-yl]-5-propylpyrazole-3-carboxamide |
| SMILES | CCCc1cc(C(=O)N[C@@H](CC(=O)NO)Cc2ccccc2)nn1Cc1c(F)cc(-c2ccccc2S(=O)(=O)NC(C)=O)cc1F |
| InChI | InChI=1S/C32H33F2N5O6S/c1-3-9-24-18-29(32(42)35-23(17-31(41)37-43)14-21-10-5-4-6-11-21)36-39(24)19-26-27(33)15-22(16-28(26)34)25-12-7-8-13-30(25)46(44,45)38-20(2)40/h4-8,10-13,15-16,18,23,43H,3,9,14,17,19H2,1-2H3,(H,35,42)(H,37,41)(H,38,40)/t23-/m1/s1 |
| InChIKey | ZQTGIXWCVKFFDQ-HSZRJFAPSA-N |
| XLogP | 3.89 |
| TPSA | 159.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.71 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|