C29H28FN3O4S — CID 87137529
2-[4-[[5-ethoxy-3-[[(2R)-1-phenyl-3-sulfanylpropan-2-yl]carbamoyl]pyrazol-1-yl]methyl]-3-fluorophenyl]benzoic acid (PubChem CID 87137529) has the molecular formula C29H28FN3O4S and a molecular weight of 533.63 g/mol. Its IUPAC name is 2-[4-[[5-ethoxy-3-[[(2R)-1-phenyl-3-sulfanylpropan-2-yl]carbamoyl]pyrazol-1-yl]methyl]-3-fluorophenyl]benzoic acid.
| Compound Name | 2-[4-[[5-ethoxy-3-[[(2R)-1-phenyl-3-sulfanylpropan-2-yl]carbamoyl]pyrazol-1-yl]methyl]-3-fluorophenyl]benzoic acid |
|---|---|
| PubChem CID | 87137529 |
| Molecular Formula | C29H28FN3O4S |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.18 |
| IUPAC Name | 2-[4-[[5-ethoxy-3-[[(2R)-1-phenyl-3-sulfanylpropan-2-yl]carbamoyl]pyrazol-1-yl]methyl]-3-fluorophenyl]benzoic acid |
| SMILES | CCOc1cc(C(=O)N[C@@H](CS)Cc2ccccc2)nn1Cc1ccc(-c2ccccc2C(=O)O)cc1F |
| InChI | InChI=1S/C29H28FN3O4S/c1-2-37-27-16-26(28(34)31-22(18-38)14-19-8-4-3-5-9-19)32-33(27)17-21-13-12-20(15-25(21)30)23-10-6-7-11-24(23)29(35)36/h3-13,15-16,22,38H,2,14,17-18H2,1H3,(H,31,34)(H,35,36)/t22-/m1/s1 |
| InChIKey | CAKGJKCNJYCFSD-JOCHJYFZSA-N |
| XLogP | 5.11 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|