C32H35N5O6S — CID 87138244
1-[[4-[2-(acetylsulfamoyl)phenyl]phenyl]methyl]-N-[(2R)-1-[formyl(hydroxy)amino]-3-phenylpropan-2-yl]-5-propylpyrazole-3-carboxamide (PubChem CID 87138244) has the molecular formula C32H35N5O6S and a molecular weight of 617.73 g/mol. Its IUPAC name is 1-[[4-[2-(acetylsulfamoyl)phenyl]phenyl]methyl]-N-[(2R)-1-[formyl(hydroxy)amino]-3-phenylpropan-2-yl]-5-propylpyrazole-3-carboxamide.
| Compound Name | 1-[[4-[2-(acetylsulfamoyl)phenyl]phenyl]methyl]-N-[(2R)-1-[formyl(hydroxy)amino]-3-phenylpropan-2-yl]-5-propylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 87138244 |
| Molecular Formula | C32H35N5O6S |
| Molecular Weight | 617.73 g/mol |
| Exact Mass | 617.23 |
| IUPAC Name | 1-[[4-[2-(acetylsulfamoyl)phenyl]phenyl]methyl]-N-[(2R)-1-[formyl(hydroxy)amino]-3-phenylpropan-2-yl]-5-propylpyrazole-3-carboxamide |
| SMILES | CCCc1cc(C(=O)N[C@H](Cc2ccccc2)CN(O)C=O)nn1Cc1ccc(-c2ccccc2S(=O)(=O)NC(C)=O)cc1 |
| InChI | InChI=1S/C32H35N5O6S/c1-3-9-28-19-30(32(40)33-27(21-36(41)22-38)18-24-10-5-4-6-11-24)34-37(28)20-25-14-16-26(17-15-25)29-12-7-8-13-31(29)44(42,43)35-23(2)39/h4-8,10-17,19,22,27,41H,3,9,18,20-21H2,1-2H3,(H,33,40)(H,35,39)/t27-/m1/s1 |
| InChIKey | KNBIWBSYUHNGEL-HHHXNRCGSA-N |
| XLogP | 3.56 |
| TPSA | 150.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.73 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|