C37H34N4O2S — CID 70146598
N-[(dimethylamino)methyl]-2-[4-[(2,4,5-triphenylimidazol-1-yl)methyl]phenyl]benzenesulfonamide (PubChem CID 70146598) has the molecular formula C37H34N4O2S and a molecular weight of 598.77 g/mol. Its IUPAC name is N-[(dimethylamino)methyl]-2-[4-[(2,4,5-triphenylimidazol-1-yl)methyl]phenyl]benzenesulfonamide.
| Compound Name | N-[(dimethylamino)methyl]-2-[4-[(2,4,5-triphenylimidazol-1-yl)methyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 70146598 |
| Molecular Formula | C37H34N4O2S |
| Molecular Weight | 598.77 g/mol |
| Exact Mass | 598.24 |
| IUPAC Name | N-[(dimethylamino)methyl]-2-[4-[(2,4,5-triphenylimidazol-1-yl)methyl]phenyl]benzenesulfonamide |
| SMILES | CN(C)CNS(=O)(=O)c1ccccc1-c1ccc(Cn2c(-c3ccccc3)nc(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C37H34N4O2S/c1-40(2)27-38-44(42,43)34-21-13-12-20-33(34)29-24-22-28(23-25-29)26-41-36(31-16-8-4-9-17-31)35(30-14-6-3-7-15-30)39-37(41)32-18-10-5-11-19-32/h3-25,38H,26-27H2,1-2H3 |
| InChIKey | GDTYYZOTGXYYID-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.77 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|