C19H14F3N3 — CID 102259553
9-[[4-(trifluoromethyl)phenyl]methyl]pyrido[3,4-b]indol-3-amine (PubChem CID 102259553) has the molecular formula C19H14F3N3 and a molecular weight of 341.34 g/mol. Its IUPAC name is 9-[[4-(trifluoromethyl)phenyl]methyl]pyrido[3,4-b]indol-3-amine.
| Compound Name | 9-[[4-(trifluoromethyl)phenyl]methyl]pyrido[3,4-b]indol-3-amine |
|---|---|
| PubChem CID | 102259553 |
| Molecular Formula | C19H14F3N3 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 9-[[4-(trifluoromethyl)phenyl]methyl]pyrido[3,4-b]indol-3-amine |
| SMILES | Nc1cc2c3ccccc3n(Cc3ccc(C(F)(F)F)cc3)c2cn1 |
| InChI | InChI=1S/C19H14F3N3/c20-19(21,22)13-7-5-12(6-8-13)11-25-16-4-2-1-3-14(16)15-9-18(23)24-10-17(15)25/h1-10H,11H2,(H2,23,24) |
| InChIKey | MDKUTHUKYWMUNZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |