C20H16FN3O2 — CID 3013467
9-[(4-fluorophenyl)methyl]-N-hydroxy-N-methylpyrido[3,4-b]indole-3-carboxamide (PubChem CID 3013467) has the molecular formula C20H16FN3O2 and a molecular weight of 349.37 g/mol. Its IUPAC name is 9-[(4-fluorophenyl)methyl]-N-hydroxy-N-methylpyrido[3,4-b]indole-3-carboxamide.
| Compound Name | 9-[(4-fluorophenyl)methyl]-N-hydroxy-N-methylpyrido[3,4-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 3013467 |
| Molecular Formula | C20H16FN3O2 |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 9-[(4-fluorophenyl)methyl]-N-hydroxy-N-methylpyrido[3,4-b]indole-3-carboxamide |
| SMILES | CN(O)C(=O)c1cc2c3ccccc3n(Cc3ccc(F)cc3)c2cn1 |
| InChI | InChI=1S/C20H16FN3O2/c1-23(26)20(25)17-10-16-15-4-2-3-5-18(15)24(19(16)11-22-17)12-13-6-8-14(21)9-7-13/h2-11,26H,12H2,1H3 |
| InChIKey | RYZKQKZUMWOKKS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|