About methyl 9-[(3,5-dinitrophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate
methyl 9-[(3,5-dinitrophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate (PubChem CID 18412208) has the molecular formula C20H14N4O6
and a molecular weight of 406.35 g/mol. Its IUPAC name is methyl 9-[(3,5-dinitrophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 9-[(3,5-dinitrophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate |
| PubChem CID | 18412208 |
| Molecular Formula | C20H14N4O6 |
| Molecular Weight | 406.35 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | methyl 9-[(3,5-dinitrophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)c1cc2c3ccccc3n(Cc3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)c2cn1 |
| InChI | InChI=1S/C20H14N4O6/c1-30-20(25)17-9-16-15-4-2-3-5-18(15)22(19(16)10-21-17)11-12-6-13(23(26)27)8-14(7-12)24(28)29/h2-10H,11H2,1H3 |
| InChIKey | IHZDXIQPELVEOB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 130.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 9-[(3,5-dinitrophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 9-[(3,5-dinitrophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate?
The IUPAC name of methyl 9-[(3,5-dinitrophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate (CID 18412208) is methyl 9-[(3,5-dinitrophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate.
What is the SMILES notation for methyl 9-[(3,5-dinitrophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate?
The canonical SMILES for methyl 9-[(3,5-dinitrophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate is COC(=O)c1cc2c3ccccc3n(Cc3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)c2cn1.
What is the InChIKey of methyl 9-[(3,5-dinitrophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate?
The InChIKey is IHZDXIQPELVEOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N4O6/c1-30-20(25)17-9-16-15-4-2-3-5-18(15)22(19(16)10-21-17)11-12-6-13(23(26)27)8-14(7-12)24(28)29/h2-10H,11H2,1H3.
What are the key properties of methyl 9-[(3,5-dinitrophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate?
methyl 9-[(3,5-dinitrophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate has a molecular weight of 406.35 g/mol, XLogP of 3.84, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 9-[(3,5-dinitrophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate is sourced from PubChem (CID 18412208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).