C20H14N4O6 — CID 18412208
methyl 9-[(3,5-dinitrophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate (PubChem CID 18412208) has the molecular formula C20H14N4O6 and a molecular weight of 406.35 g/mol. Its IUPAC name is methyl 9-[(3,5-dinitrophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl 9-[(3,5-dinitrophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 18412208 |
| Molecular Formula | C20H14N4O6 |
| Molecular Weight | 406.35 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | methyl 9-[(3,5-dinitrophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)c1cc2c3ccccc3n(Cc3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)c2cn1 |
| InChI | InChI=1S/C20H14N4O6/c1-30-20(25)17-9-16-15-4-2-3-5-18(15)22(19(16)10-21-17)11-12-6-13(23(26)27)8-14(7-12)24(28)29/h2-10H,11H2,1H3 |
| InChIKey | IHZDXIQPELVEOB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 130.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|