C45H35BrN4O4 — CID 157302089
benzyl 9-benzylpyrido[3,4-b]indole-3-carboxylate;bromomethylbenzene;9H-pyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 157302089) has the molecular formula C45H35BrN4O4 and a molecular weight of 775.70 g/mol. Its IUPAC name is benzyl 9-benzylpyrido[3,4-b]indole-3-carboxylate;bromomethylbenzene;9H-pyrido[3,4-b]indole-3-carboxylic acid.
| Compound Name | benzyl 9-benzylpyrido[3,4-b]indole-3-carboxylate;bromomethylbenzene;9H-pyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 157302089 |
| Molecular Formula | C45H35BrN4O4 |
| Molecular Weight | 775.70 g/mol |
| Exact Mass | 774.18 |
| IUPAC Name | benzyl 9-benzylpyrido[3,4-b]indole-3-carboxylate;bromomethylbenzene;9H-pyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | BrCc1ccccc1.O=C(O)c1cc2c(cn1)[nH]c1ccccc12.O=C(OCc1ccccc1)c1cc2c3ccccc3n(Cc3ccccc3)c2cn1 |
| InChI | InChI=1S/C26H20N2O2.C12H8N2O2.C7H7Br/c29-26(30-18-20-11-5-2-6-12-20)23-15-22-21-13-7-8-14-24(21)28(25(22)16-27-23)17-19-9-3-1-4-10-19;15-12(16)10-5-8-7-3-1-2-4-9(7)14-11(8)6-13-10;8-6-7-4-2-1-3-5-7/h1-16H,17-18H2;1-6,14H,(H,15,16);1-5H,6H2 |
| InChIKey | BCAGPNNYIPZOQA-UHFFFAOYSA-N |
| XLogP | 10.59 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.70 |
| LogP ≤ 5 | 10.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|